EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H20 |
| Net Charge | 0 |
| Average Mass | 500.600 |
| Monoisotopic Mass | 500.15650 |
| SMILES | c1cc2cccc3c4ccc5c6ccc7c8cccc9cccc(c%10ccc(c%11ccc(c(c1)c23)c4c%115)c6c%107)c98 |
| InChI | InChI=1S/C40H20/c1-5-21-6-2-10-24-28-14-18-32-34-20-16-30-26-12-4-8-22-7-3-11-25(36(22)26)29-15-19-33(40(34)38(29)30)31-17-13-27(37(28)39(31)32)23(9-1)35(21)24/h1-20H |
| InChIKey | GGVMPKQSTZIOIU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quaterrylene (CHEBI:51410) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| IUPAC Name |
|---|
| benzo[5,10]anthra[9,1,2-cde]dibenzo[kl,rst]pentaphene |
| Synonyms | Source |
|---|---|
| benzo[10,5]anthra[9,1,2-cde]dibenzo[kl,rst]pentaphene | NIST Chemistry WebBook |
| benzo[1,2,3-cd:4,5,6-c'd']diperylene | NIST Chemistry WebBook |