EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H16 |
| Net Charge | 0 |
| Average Mass | 520.590 |
| Monoisotopic Mass | 520.12520 |
| SMILES | c1cc2cc3ccc4cc5ccc6ccc7cc8ccc9cc%10ccc1c1c2c2c3c4c3c5c6c7c4c8c9c(c%101)c2c34 |
| InChI | InChI=1S/C42H16/c1-5-19-13-23-9-10-25-15-21-7-3-18-4-8-22-16-26-12-11-24-14-20-6-2-17(1)27-29(19)37-33(23)35(25)39-31(21)28(18)32(22)40-36(26)34(24)38(30(20)27)41(37)42(39)40/h1-16H |
| InChIKey | QYQKNXGEKCVVCL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| circumpyrene (CHEBI:51401) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| IUPAC Name |
|---|
| dinaphtho[2,1,8,7-hijk:2',1',8',7'-stuv]ovalene |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2653102 | Gmelin |
| Beilstein:6453338 | Beilstein |