EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8O5 |
| Net Charge | 0 |
| Average Mass | 244.202 |
| Monoisotopic Mass | 244.03717 |
| SMILES | O=c1c2cccc(O)c2oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C13H8O5/c14-6-4-9(16)11-10(5-6)18-13-7(12(11)17)2-1-3-8(13)15/h1-5,14-16H |
| InChIKey | XESIWQIMUSNPRO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anaxagorea luzonensis (ncbitaxon:235716) | - | PubMed (10959592) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,5-trihydroxyxanthone (CHEBI:514) has role plant metabolite (CHEBI:76924) |
| 1,3,5-trihydroxyxanthone (CHEBI:514) is a polyphenol (CHEBI:26195) |
| 1,3,5-trihydroxyxanthone (CHEBI:514) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,3,5-trihydroxy-9H-xanthen-9-one |
| Citations |
|---|