EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O |
| Net Charge | 0 |
| Average Mass | 270.376 |
| Monoisotopic Mass | 270.17321 |
| SMILES | CN(C)CCOC(C)(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C17H22N2O/c1-17(20-14-13-19(2)3,15-9-5-4-6-10-15)16-11-7-8-12-18-16/h4-12H,13-14H2,1-3H3 |
| InChIKey | HCFDWZZGGLSKEP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxylamine (CHEBI:51380) has role anti-allergic agent (CHEBI:50857) |
| doxylamine (CHEBI:51380) has role antiemetic (CHEBI:50919) |
| doxylamine (CHEBI:51380) has role antitussive (CHEBI:51177) |
| doxylamine (CHEBI:51380) has role cholinergic antagonist (CHEBI:48873) |
| doxylamine (CHEBI:51380) has role H1-receptor antagonist (CHEBI:37955) |
| doxylamine (CHEBI:51380) has role histamine antagonist (CHEBI:37956) |
| doxylamine (CHEBI:51380) has role sedative (CHEBI:35717) |
| doxylamine (CHEBI:51380) is a pyridines (CHEBI:26421) |
| doxylamine (CHEBI:51380) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| N,N-dimethyl-2-(1-phenyl-1-pyridin-2-ylethoxy)ethanamine |
| INNs | Source |
|---|---|
| doxilamina | WHO MedNet |
| doxylamine | WHO MedNet |
| doxylamine | KEGG DRUG |
| doxylaminum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(alpha-(2-(Dimethylamino)ethoxy)-alpha-methylbenzyl)pyridine | ChemIDplus |
| 2-Dimethylaminoethoxyphenylmethyl-2-picoline | ChemIDplus |
| Dossilamina | ChemIDplus |
| Doxilminio | ChemIDplus |
| N,N-Dimethyl-2-(1-phenyl-1-(2-pyridinyl)ethoxy)ethanamine | ChemIDplus |
| Phenyl-2-pyridylmethyl-beta-N,N-dimethylaminoethyl ether | ChemIDplus |