EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21F3N2O2 |
| Net Charge | 0 |
| Average Mass | 318.339 |
| Monoisotopic Mass | 318.15551 |
| SMILES | COCCCC/C(=N\OCCN)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3N2O2/c1-21-10-3-2-4-14(20-22-11-9-19)12-5-7-13(8-6-12)15(16,17)18/h5-8H,2-4,9-11,19H2,1H3/b20-14+ |
| InChIKey | CJOFXWAVKWHTFT-XSFVSMFZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluvoxamine (CHEBI:5138) has functional parent (trifluoromethyl)benzene (CHEBI:36810) |
| fluvoxamine (CHEBI:5138) has role antidepressant (CHEBI:35469) |
| fluvoxamine (CHEBI:5138) has role anxiolytic drug (CHEBI:35474) |
| fluvoxamine (CHEBI:5138) has role serotonin uptake inhibitor (CHEBI:50949) |
| fluvoxamine (CHEBI:5138) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| fluvoxamine (CHEBI:5138) is a 5-methoxyvalerophenone O-(2-aminoethyl)oxime (CHEBI:36815) |
| IUPAC Name |
|---|
| (1E)-5-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-1-one O-(2-aminoethyl)oxime |
| INNs | Source |
|---|---|
| fluvoxamina | WHO MedNet |
| fluvoxamine | ChemIDplus |
| fluvoxamine | WHO MedNet |
| fluvoxaminum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-{[(E)-{5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}amino]oxy}ethan-1-amine | IUPAC |
| O-(2-aminoethyl)-N-{(1E)-5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene}hydroxylamine | IUPAC |
| Fluvoxamine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5583954 | Beilstein |
| CAS:54739-18-3 | NIST Chemistry WebBook |
| CAS:54739-18-3 | ChemIDplus |
| CAS:54739-18-3 | KEGG COMPOUND |
| Citations |
|---|