EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12Cl2N2O |
| Net Charge | 0 |
| Average Mass | 259.136 |
| Monoisotopic Mass | 258.03267 |
| SMILES | CC(Oc1c(Cl)cccc1Cl)C1=NCCN1 |
| InChI | InChI=1S/C11H12Cl2N2O/c1-7(11-14-5-6-15-11)16-10-8(12)3-2-4-9(10)13/h2-4,7H,5-6H2,1H3,(H,14,15) |
| InChIKey | KSMAGQUYOIHWFS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lofexidine (CHEBI:51368) has role antihypertensive agent (CHEBI:35674) |
| lofexidine (CHEBI:51368) has role α-adrenergic agonist (CHEBI:35569) |
| lofexidine (CHEBI:51368) is a aromatic ether (CHEBI:35618) |
| lofexidine (CHEBI:51368) is a carboxamidine (CHEBI:35359) |
| lofexidine (CHEBI:51368) is a dichlorobenzene (CHEBI:23697) |
| lofexidine (CHEBI:51368) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| 2-[1-(2,6-dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole |
| INNs | Source |
|---|---|
| lofexidina | WHO MedNet |
| lofexidine | ChemIDplus |
| lofexidine | WHO MedNet |
| lofexidinum | WHO MedNet |
| Synonym | Source |
|---|---|
| 2-(alpha-(2,6-Dichlorophenoxy)ethyl)2-imidazoline | ChemIDplus |