EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5135 - fluvalinate
| Formula | C26H22ClF3N2O3 |
| Net Charge | 0 |
| Average Mass | 502.920 |
| Monoisotopic Mass | 502.12710 |
| SMILES | CC(C)C(Nc1ccc(C(F)(F)F)cc1Cl)C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C26H22ClF3N2O3/c1-16(2)24(32-22-12-11-18(14-21(22)27)26(28,29)30)25(33)35-23(15-31)17-7-6-10-20(13-17)34-19-8-4-3-5-9-19/h3-14,16,23-24,32H,1-2H3 |
| InChIKey | INISTDXBRIBGOC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluvalinate (CHEBI:5135) has functional parent valine (CHEBI:27266) |
| fluvalinate (CHEBI:5135) has role agrochemical (CHEBI:33286) |
| fluvalinate (CHEBI:5135) has role pyrethroid ester acaricide (CHEBI:39259) |
| fluvalinate (CHEBI:5135) has role pyrethroid ester insecticide (CHEBI:39116) |
| fluvalinate (CHEBI:5135) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| fluvalinate (CHEBI:5135) is a aromatic ether (CHEBI:35618) |
| fluvalinate (CHEBI:5135) is a monochlorobenzenes (CHEBI:83403) |
| fluvalinate (CHEBI:5135) is a nitrile (CHEBI:18379) |
| fluvalinate (CHEBI:5135) is a organochlorine acaricide (CHEBI:38657) |
| fluvalinate (CHEBI:5135) is a organochlorine insecticide (CHEBI:25705) |
| fluvalinate (CHEBI:5135) is a organofluorine acaricide (CHEBI:38806) |
| fluvalinate (CHEBI:5135) is a organofluorine insecticide (CHEBI:38804) |
| Incoming Relation(s) |
| tau-fluvalinate (CHEBI:39367) is a fluvalinate (CHEBI:5135) |
| IUPAC Name |
|---|
| cyano(3-phenoxyphenyl)methyl N-[2-chloro-4-(trifluoromethyl)phenyl]valinate |
| Synonym | Source |
|---|---|
| Fluvalinate | KEGG COMPOUND |