EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2 |
| Net Charge | 0 |
| Average Mass | 240.350 |
| Monoisotopic Mass | 240.16265 |
| SMILES | c1ccc(CNCCNCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H20N2/c1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2 |
| InChIKey | JUHORIMYRDESRB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzathine (CHEBI:51344) is a diamine (CHEBI:23666) |
| benzathine (CHEBI:51344) is conjugate base of benzathine(1+) (CHEBI:51346) |
| Incoming Relation(s) |
| benzathine(1+) (CHEBI:51346) is conjugate acid of benzathine (CHEBI:51344) |
| IUPAC Name |
|---|
| N,N'-dibenzylethane-1,2-diamine |
| Synonyms | Source |
|---|---|
| 1,2-bis(benzylamino)ethane | NIST Chemistry WebBook |
| DBED | ChemIDplus |
| N,N'-dibenzyl-1,2-ethylenediamine | NIST Chemistry WebBook |
| N,N'-dibenzylethylenediamine | NIST Chemistry WebBook |