EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27F3O4S |
| Net Charge | 0 |
| Average Mass | 444.515 |
| Monoisotopic Mass | 444.15822 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)SCF)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])C[C@H](F)C2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C22H27F3O4S/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-19(15,2)21(14,25)17(27)9-20(13,3)22(11,29)18(28)30-10-23/h4-5,7,11,13-14,16-17,27,29H,6,8-10H2,1-3H3/t11-,13+,14+,16+,17+,19+,20+,21+,22+/m1/s1 |
| InChIKey | MGNNYOODZCAHBA-GQKYHHCASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| Applications: | anti-asthmatic drug A drug used to treat asthma. anti-asthmatic agent Any compound that has anti-asthmatic effects. anti-allergic agent A drug used to treat allergic reactions. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluticasone (CHEBI:5134) has parent hydride androstane (CHEBI:35509) |
| fluticasone (CHEBI:5134) has role androgen (CHEBI:50113) |
| fluticasone (CHEBI:5134) has role anti-allergic agent (CHEBI:50857) |
| fluticasone (CHEBI:5134) has role anti-asthmatic agent (CHEBI:65023) |
| fluticasone (CHEBI:5134) has role anti-asthmatic drug (CHEBI:49167) |
| fluticasone (CHEBI:5134) has role hypoglycemic agent (CHEBI:35526) |
| fluticasone (CHEBI:5134) is a 11β-hydroxy steroid (CHEBI:35346) |
| fluticasone (CHEBI:5134) is a 17α-hydroxy steroid (CHEBI:35342) |
| fluticasone (CHEBI:5134) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| fluticasone (CHEBI:5134) is a corticosteroid (CHEBI:50858) |
| fluticasone (CHEBI:5134) is a fluorinated steroid (CHEBI:50830) |
| fluticasone (CHEBI:5134) is a thioester (CHEBI:51277) |
| Incoming Relation(s) |
| fluticasone furoate (CHEBI:74899) has functional parent fluticasone (CHEBI:5134) |
| fluticasone propionate (CHEBI:31441) has functional parent fluticasone (CHEBI:5134) |
| IUPAC Name |
|---|
| S-(fluoromethyl) (6α,11β,16α,17α)-6,9-difluoro-11,17-dihydroxy-16-methyl-3-oxoandrosta-1,4-diene-17-carbothioate |
| INNs | Source |
|---|---|
| fluticasona | ChemIDplus |
| fluticasone | KEGG DRUG |
| fluticasone | WHO MedNet |
| fluticasonum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07815 | KEGG COMPOUND |
| D07981 | KEGG DRUG |
| Fluticasone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8173308 | Reaxys |
| CAS:90566-53-3 | ChemIDplus |
| CAS:90566-53-3 | KEGG COMPOUND |
| Citations |
|---|