EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N4O7 |
| Net Charge | 0 |
| Average Mass | 414.374 |
| Monoisotopic Mass | 414.11755 |
| SMILES | O=C(O)c1cccc(C(=O)CC[C@H]2O[C@@H](n3cnc4c(=O)ncnc43)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C19H18N4O7/c24-11(9-2-1-3-10(6-9)19(28)29)4-5-12-14(25)15(26)18(30-12)23-8-22-13-16(23)20-7-21-17(13)27/h1-3,6-8,12,14-15,18,25-26H,4-5H2,(H,28,29)(H,20,21,27)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | VEDWXCWBMDQNCV-SCFUHWHPSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| futalosine (CHEBI:51310) is a inosines (CHEBI:24844) |
| futalosine (CHEBI:51310) is conjugate acid of futalosinate (CHEBI:58863) |
| Incoming Relation(s) |
| cyclic dehypoxanthinylfutalosine (CHEBI:64252) has functional parent futalosine (CHEBI:51310) |
| dehypoxanthine futalosine (CHEBI:51312) has functional parent futalosine (CHEBI:51310) |
| futalosinate (CHEBI:58863) is conjugate base of futalosine (CHEBI:51310) |
| IUPAC Name |
|---|
| 3-{3-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1,6-dihydro-9H-purin-9-yl)tetrahydrofuran-2-yl]propanoyl}benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| C16999 | KEGG COMPOUND |