EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5131 - flurochloridone
| Formula | C12H10Cl2F3NO |
| Net Charge | 0 |
| Average Mass | 312.118 |
| Monoisotopic Mass | 311.00915 |
| SMILES | O=C1C(Cl)C(CCl)CN1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10Cl2F3NO/c13-5-7-6-18(11(19)10(7)14)9-3-1-2-8(4-9)12(15,16)17/h1-4,7,10H,5-6H2 |
| InChIKey | OQZCSNDVOWYALR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flurochloridone (CHEBI:5131) has role agrochemical (CHEBI:33286) |
| flurochloridone (CHEBI:5131) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| flurochloridone (CHEBI:5131) has role herbicide (CHEBI:24527) |
| flurochloridone (CHEBI:5131) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| flurochloridone (CHEBI:5131) is a organochlorine compound (CHEBI:36683) |
| flurochloridone (CHEBI:5131) is a pyrrolidines (CHEBI:38260) |
| Synonyms | Source |
|---|---|
| Flurochloridone | KEGG COMPOUND |
| Raiser | KEGG COMPOUND |