EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26F3N3OS.2HCl |
| Net Charge | 0 |
| Average Mass | 510.453 |
| Monoisotopic Mass | 509.12822 |
| SMILES | Cl.Cl.OCCN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C22H26F3N3OS.2ClH/c23-22(24,25)17-6-7-21-19(16-17)28(18-4-1-2-5-20(18)30-21)9-3-8-26-10-12-27(13-11-26)14-15-29;;/h1-2,4-7,16,29H,3,8-15H2;2*1H |
| InChIKey | MBHNWCYEGXQEIT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fluphenazine hydrochloride (CHEBI:5126) has role anticoronaviral agent (CHEBI:149553) |
| Fluphenazine hydrochloride (CHEBI:5126) has role antineoplastic agent (CHEBI:35610) |
| Fluphenazine hydrochloride (CHEBI:5126) has role antipsychotic agent (CHEBI:35476) |
| Fluphenazine hydrochloride (CHEBI:5126) is a phenothiazines (CHEBI:38093) |
| Synonyms | Source |
|---|---|
| Anatensol | ChEMBL |
| Dapotum | ChEMBL |
| Fluphenazine hydrochloride | KEGG COMPOUND |
| Fluphenazini hydrochloridum | ChEMBL |
| NSC-179197 | ChEMBL |
| Permitil | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Moditen | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00791 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:146-56-5 | KEGG COMPOUND |
| Citations |
|---|