EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38F3N3O2S |
| Net Charge | 0 |
| Average Mass | 549.703 |
| Monoisotopic Mass | 549.26368 |
| SMILES | CCCCCCC(=O)OCCN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C29H38F3N3O2S/c1-2-3-4-5-11-28(36)37-21-20-34-18-16-33(17-19-34)14-8-15-35-24-9-6-7-10-26(24)38-27-13-12-23(22-25(27)35)29(30,31)32/h6-7,9-10,12-13,22H,2-5,8,11,14-21H2,1H3 |
| InChIKey | LRWSFOSWNAQHHW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antipsoriatic A drug used to treat psoriasis. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fluphenazine enanthate (CHEBI:5125) has role antidepressant (CHEBI:35469) |
| Fluphenazine enanthate (CHEBI:5125) has role antipsoriatic (CHEBI:50748) |
| Fluphenazine enanthate (CHEBI:5125) has role antipsychotic agent (CHEBI:35476) |
| Fluphenazine enanthate (CHEBI:5125) has role anxiolytic drug (CHEBI:35474) |
| Fluphenazine enanthate (CHEBI:5125) is a phenothiazines (CHEBI:38093) |
| Synonyms | Source |
|---|---|
| Flufenan | ChEMBL |
| Fluphenazine enantate | ChEMBL |
| Fluphenazine enanthate | KEGG COMPOUND |
| Fluphenazini enantas | ChEMBL |
| moditen enanthate | DrugCentral |
| Prolixin enanthate | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Moditen enant | ChEMBL |
| Citations |
|---|