EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34N4 |
| Net Charge | +2 |
| Average Mass | 414.597 |
| Monoisotopic Mass | 414.27725 |
| SMILES | CC[N+](C)(CC)CCC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21 |
| InChI | InChI=1S/C27H33N4/c1-4-31(3,5-2)17-9-16-30-26-19-22(29)13-15-24(26)23-14-12-21(28)18-25(23)27(30)20-10-7-6-8-11-20/h6-8,10-15,18-19,29H,4-5,9,16-17,28H2,1-3H3/q+1/p+1 |
| InChIKey | ZDWVWKDAWBGPDN-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Role: | intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propidium (CHEBI:51246) has role fluorochrome (CHEBI:51217) |
| propidium (CHEBI:51246) has role intercalator (CHEBI:24853) |
| propidium (CHEBI:51246) is a phenanthridines (CHEBI:51245) |
| propidium (CHEBI:51246) is a quaternary ammonium ion (CHEBI:35267) |
| Incoming Relation(s) |
| propidium iodide (CHEBI:51240) has part propidium (CHEBI:51246) |
| IUPAC Name |
|---|
| 3,8-diamino-5-{3-[diethyl(methyl)ammonio]propyl}-6-phenylphenanthridinium |
| Synonyms | Source |
|---|---|
| 3,8-diamino-5-(3-(diethylmethylammonio)propyl)-6-phenylphenanthridinium | ChemIDplus |
| 3,8-DIAMINO-5[3-(DIETHYLMETHYLAMMONIO)PROPYL]-6-PHENYLPHENANTHRIDINIUM | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3729792 | Beilstein |
| CAS:36015-30-2 | ChemIDplus |