EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H28MgN4 |
| Net Charge | 0 |
| Average Mass | 637.041 |
| Monoisotopic Mass | 636.21644 |
| SMILES | C1=C/C2=C(\c3ccccc3)c3ccc4[n]3[Mg][n]3/c(cc/c3=C(\c3ccccc3)C3=N/C(=C\4c4ccccc4)C=C3)=C(/c3ccccc3)C1=N2 |
| InChI | InChI=1S/C44H28N4.Mg/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;/h1-28H;/q-2;+2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | XEHJAWQTIIXDON-DAJBKUBHSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnesium tetraphenylporphyrin (CHEBI:51228) has role fluorochrome (CHEBI:51217) |
| magnesium tetraphenylporphyrin (CHEBI:51228) is a magnesium porphyrin (CHEBI:25111) |
| IUPAC Name |
|---|
| [5,10,15,20-tetraphenylporphyrinato(2−)-κ4N21,N22,N23,N24]magnesium |
| Synonym | Source |
|---|---|
| magnesium meso-tetraphenylporphine | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Gmelin:468198 | Gmelin |
| CAS:14640-21-2 | NIST Chemistry WebBook |
| CAS:14640-21-2 | ChemIDplus |