EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51227 - magnesium octaethylporphyrin
| Formula | C36H44MgN4 |
| Net Charge | 0 |
| Average Mass | 557.081 |
| Monoisotopic Mass | 556.34164 |
| SMILES | CCC1=C(CC)/C2=C/c3c(CC)c(CC)c4[n]3[Mg][n]3/c(c(CC)c(CC)/c3=C/C3=N/C(=C\4)C(CC)=C3CC)=C\C1=N2 |
| InChI | InChI=1S/C36H44N4.Mg/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20H,9-16H2,1-8H3;/q-2;+2/b29-17-,30-18-,31-17-,32-18-,33-19-,34-20-,35-19-,36-20-; |
| InChIKey | TVLQTHMQVIWHGP-XTPDIVBZSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnesium octaethylporphyrin (CHEBI:51227) has role fluorochrome (CHEBI:51217) |
| magnesium octaethylporphyrin (CHEBI:51227) is a magnesium porphyrin (CHEBI:25111) |
| IUPAC Name |
|---|
| [2,3,7,8,12,13,17,18-octaethylporphyrinato(2−)-κ4N21,N22,N23,N24]magnesium |
| Synonyms | Source |
|---|---|
| 2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphine magnesium | NIST Chemistry WebBook |
| MgOEP | ChemIDplus |
| 2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphine magnesium(II) | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Gmelin:90834 | Gmelin |
| Beilstein:1235208 | Beilstein |
| CAS:20910-35-4 | NIST Chemistry WebBook |
| CAS:20910-35-4 | ChemIDplus |