EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H52N4Zn |
| Net Charge | 0 |
| Average Mass | 846.450 |
| Monoisotopic Mass | 844.34834 |
| SMILES | Cc1cc(C)c(C2=C3C=CC4=[N]3[Zn]35[N]6=C(C=CC6=C(c6c(C)cc(C)cc6C)c6ccc2[n]63)C(c2c(C)cc(C)cc2C)=c2ccc([n]25)=C4c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C56H52N4.Zn/c1-29-21-33(5)49(34(6)22-29)53-41-13-15-43(57-41)54(50-35(7)23-30(2)24-36(50)8)45-17-19-47(59-45)56(52-39(11)27-32(4)28-40(52)12)48-20-18-46(60-48)55(44-16-14-42(53)58-44)51-37(9)25-31(3)26-38(51)10;/h13-28H,1-12H3;/q-2;+2/b53-41+,53-42+,54-43+,54-45+,55-44+,55-46+,56-47+,56-48+; |
| InChIKey | XVBBVBUMPPXULW-XYIYAAJRSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zinc tetramesitylporphyrin (CHEBI:51220) has role fluorochrome (CHEBI:51217) |
| zinc tetramesitylporphyrin (CHEBI:51220) is a zinc porphyrin (CHEBI:51216) |
| IUPAC Name |
|---|
| [5,10,15,20-tetrakis(2,4,6-trimethylphenyl)porphyrinato(2−)-κ4N21,N22,N23,N24]zinc |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4648207 | Beilstein |