EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23NO2 |
| Net Charge | 0 |
| Average Mass | 249.354 |
| Monoisotopic Mass | 249.17288 |
| SMILES | C=CCc1ccccc1OCC(O)CNC(C)C |
| InChI | InChI=1S/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3 |
| InChIKey | PAZJSJFMUHDSTF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. sympatholytic agent Any compound which inhibits the postganglionic functioning of the sympathetic nervous system (SNS). anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alprenolol (CHEBI:51211) has role anti-arrhythmia drug (CHEBI:38070) |
| alprenolol (CHEBI:51211) has role antihypertensive agent (CHEBI:35674) |
| alprenolol (CHEBI:51211) has role sympatholytic agent (CHEBI:66991) |
| alprenolol (CHEBI:51211) has role β-adrenergic antagonist (CHEBI:35530) |
| alprenolol (CHEBI:51211) is a secondary alcohol (CHEBI:35681) |
| alprenolol (CHEBI:51211) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| alprenolol hydrochloride (CHEBI:31191) has part alprenolol (CHEBI:51211) |
| IUPAC Name |
|---|
| 1-[2-(propen-2-ylphenoxy)]-3-(isopropylamino)propan-2-ol |
| INNs | Source |
|---|---|
| alprenolol | ChemIDplus |
| alprénolol | WHO MedNet |
| alprenolol | WHO MedNet |
| alprenololum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(2-Allylphenoxy)-3-isopropylamino-2-propanol | ChemIDplus |
| 1-(o-Allylphenoxy)-3-(isopropylamino)-2-propanol | ChemIDplus |
| Alfeprol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D07156 | KEGG DRUG |
| DB00866 | DrugBank |
| NL6605692 | Patent |
| NL6612958 | Patent |
| Alprenolol | Wikipedia |
| HMDB0015004 | HMDB |
| LSM-1238 | LINCS |
| 137 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1913441 | Reaxys |
| CAS:13655-52-2 | ChemIDplus |
| Citations |
|---|