EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO |
| Net Charge | 0 |
| Average Mass | 165.236 |
| Monoisotopic Mass | 165.11536 |
| SMILES | CN[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10+/m0/s1 |
| InChIKey | KWGRBVOPPLSCSI-WCBMZHEXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. central nervous system drug A class of drugs producing both physiological and psychological effects through a variety of mechanisms involving the central nervous system. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. vasoconstrictor agent Drug used to cause constriction of the blood vessels. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. anti-asthmatic drug A drug used to treat asthma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pseudoephedrine (CHEBI:51209) has role anti-asthmatic drug (CHEBI:49167) |
| pseudoephedrine (CHEBI:51209) has role bronchodilator agent (CHEBI:35523) |
| pseudoephedrine (CHEBI:51209) has role central nervous system drug (CHEBI:35470) |
| pseudoephedrine (CHEBI:51209) has role nasal decongestant (CHEBI:77715) |
| pseudoephedrine (CHEBI:51209) has role plant metabolite (CHEBI:76924) |
| pseudoephedrine (CHEBI:51209) has role sympathomimetic agent (CHEBI:35524) |
| pseudoephedrine (CHEBI:51209) has role vasoconstrictor agent (CHEBI:50514) |
| pseudoephedrine (CHEBI:51209) has role xenobiotic (CHEBI:35703) |
| pseudoephedrine (CHEBI:51209) is a phenylethanolamines (CHEBI:25990) |
| pseudoephedrine (CHEBI:51209) is a secondary alcohol (CHEBI:35681) |
| pseudoephedrine (CHEBI:51209) is a secondary amino compound (CHEBI:50995) |
| pseudoephedrine (CHEBI:51209) is conjugate base of pseudoephedrine(1+) (CHEBI:132296) |
| Incoming Relation(s) |
| pseudoephedrine(1+) (CHEBI:132296) is conjugate acid of pseudoephedrine (CHEBI:51209) |
| IUPAC Name |
|---|
| (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol |
| INNs | Source |
|---|---|
| pseudoefedrina | WHO MedNet |
| pseudoephedrine | WHO MedNet |
| pseudoéphédrine | WHO MedNet |
| pseudoephedrinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (+)-(1S,2S)-Pseudoephedrine | ChemIDplus |
| (1S,2S)-(+)-Pseudoephedrine | HMDB |
| (1S,2S)-Pseudoephedrine | HMDB |
| 2-(Methylamino)-1-phenyl-1-propanol | HMDB |
| d-Isoephedrine | ChemIDplus |
| d-Pseudoephedrine | ChemIDplus |
| Citations |
|---|