EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51193 - histamine phosphate
| Formula | C5H9N3.2H3O4P |
| Net Charge | 0 |
| Average Mass | 307.136 |
| Monoisotopic Mass | 307.03344 |
| SMILES | NCCc1cncn1.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C5H9N3.2H3O4P/c6-2-1-5-3-7-4-8-5;2*1-5(2,3)4/h3-4H,1-2,6H2,(H,7,8);2*(H3,1,2,3,4) |
| InChIKey | ZHIBQGJKHVBLJJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | histamine agonist A drug that binds to and activates histamine receptors. Although they have been suggested for a variety of clinical applications, histamine agonists have so far been more widely used in research than therapeutically. |
| Application: | histamine agonist A drug that binds to and activates histamine receptors. Although they have been suggested for a variety of clinical applications, histamine agonists have so far been more widely used in research than therapeutically. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| histamine phosphate (CHEBI:51193) has part histamine (CHEBI:18295) |
| histamine phosphate (CHEBI:51193) has role histamine agonist (CHEBI:35678) |
| histamine phosphate (CHEBI:51193) is a phosphate salt (CHEBI:37853) |
| IUPAC Name |
|---|
| 2-(1H-imidazol-4-yl)ethanamine bis(phosphate) |
| Synonyms | Source |
|---|---|
| 4-(2-Aminoethyl)imidazole bis(dihydrogen phosphate) | ChemIDplus |
| 4-(2-Aminoethyl)imidazole di-acid phosphate | ChemIDplus |
| Histamine acid phosphate | ChemIDplus |
| Histamine biphosphate | ChemIDplus |
| Histamine dihydrogen phosphate | ChemIDplus |
| Histamine diphosphate | ChemIDplus |