EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29NO2 |
| Net Charge | 0 |
| Average Mass | 339.479 |
| Monoisotopic Mass | 339.21983 |
| SMILES | CCC(=O)O[C@](Cc1ccccc1)(c1ccccc1)[C@H](C)CN(C)C |
| InChI | InChI=1S/C22H29NO2/c1-5-21(24)25-22(18(2)17-23(3)4,20-14-10-7-11-15-20)16-19-12-8-6-9-13-19/h6-15,18H,5,16-17H2,1-4H3/t18-,22+/m1/s1 |
| InChIKey | XLMALTXPSGQGBX-GCJKJVERSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextropropoxyphene (CHEBI:51173) has role opioid analgesic (CHEBI:35482) |
| dextropropoxyphene (CHEBI:51173) has role μ-opioid receptor agonist (CHEBI:55322) |
| dextropropoxyphene (CHEBI:51173) is a 1-benzyl-3-(dimethylamino)-2-methyl-1-phenylpropyl propanoate (CHEBI:77401) |
| dextropropoxyphene (CHEBI:51173) is enantiomer of levopropoxyphene (CHEBI:51174) |
| Incoming Relation(s) |
| dextropropoxyphene hydrochloride (CHEBI:8498) has part dextropropoxyphene (CHEBI:51173) |
| dextropropoxyphene napsylate (CHEBI:51179) has part dextropropoxyphene (CHEBI:51173) |
| propoxyphene (CHEBI:8497) has part dextropropoxyphene (CHEBI:51173) |
| levopropoxyphene (CHEBI:51174) is enantiomer of dextropropoxyphene (CHEBI:51173) |
| IUPAC Name |
|---|
| (1S,2R)-1-benzyl-3-(dimethylamino)-2-methyl-1-phenylpropyl propanoate |
| INNs | Source |
|---|---|
| dextropropoxifeno | WHO MedNet |
| dextropropoxyphene | ChemIDplus |
| dextropropoxyphène | WHO MedNet |
| dextropropoxyphenum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (+)-1,2-Diphenyl-2-propionoxy-3-methyl-4-dimethylaminobutane | ChemIDplus |
| (+)-4-Dimethylamino-1,2-diphenyl-3-methyl-2-propionyloxybutane | ChemIDplus |
| 4-Dimethylamino-3-methyl-1,2-diphenyl-2-propoxybutane | ChemIDplus |
| alpha-(+)-4-Dimethylamino-1,2-diphenyl-3-methyl-2-butanol propionate ester | ChemIDplus |
| alpha-D-4-Dimethylamino-3-methyl-1,2-diphenyl-2-butanol-propionat | ChemIDplus |
| Destropropossifene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 844 | DrugCentral |
| C07406 | KEGG COMPOUND |
| D07809 | KEGG DRUG |
| DB00647 | DrugBank |
| HMDB0014785 | HMDB |
| Propoxyphene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3219810 | Beilstein |
| Reaxys:5605276 | Reaxys |
| CAS:469-62-5 | KEGG COMPOUND |
| CAS:469-62-5 | ChemIDplus |
| Citations |
|---|