EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3S.2HCl |
| Net Charge | 0 |
| Average Mass | 284.256 |
| Monoisotopic Mass | 283.06767 |
| SMILES | CCCN[C@H]1CCc2nc(N)sc2C1.Cl.Cl |
| InChI | InChI=1S/C10H17N3S.2ClH/c1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8;;/h7,12H,2-6H2,1H3,(H2,11,13);2*1H/t7-;;/m0../s1 |
| InChIKey | QMNWXHSYPXQFSK-KLXURFKVSA-N |
| Roles Classification |
|---|
| Biological Role: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. dopamine agonist A drug that binds to and activates dopamine receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pramipexole hydrochloride anhydrous (CHEBI:51148) has part pramipexole(2+) (CHEBI:63218) |
| pramipexole hydrochloride anhydrous (CHEBI:51148) has role antiparkinson drug (CHEBI:48407) |
| pramipexole hydrochloride anhydrous (CHEBI:51148) has role dopamine agonist (CHEBI:51065) |
| pramipexole hydrochloride anhydrous (CHEBI:51148) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| pramipexole hydrochloride (CHEBI:51147) has part pramipexole hydrochloride anhydrous (CHEBI:51148) |
| IUPAC Name |
|---|
| (6S)-N6-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine dihydrochloride |
| Synonym | Source |
|---|---|
| Pramipexole dihydrochloride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB00413 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6491969 | Beilstein |
| CAS:104632-25-9 | ChemIDplus |