EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N5OS |
| Net Charge | 0 |
| Average Mass | 269.374 |
| Monoisotopic Mass | 269.13103 |
| SMILES | [H]C(=O)CCNc1nc(NC(C)(C)C)nc(SC)n1 |
| InChI | InChI=1S/C11H19N5OS/c1-11(2,3)16-9-13-8(12-6-5-7-17)14-10(15-9)18-4/h7H,5-6H2,1-4H3,(H2,12,13,14,15,16) |
| InChIKey | XDHRLUOJUPMUQM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antifouling biocide A compound that inhibits the growth of marine organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-tert-butylamino-6-methylthiol-s-triazin-2-ylamino)propionaldehyde (CHEBI:51112) has parent hydride 1,3,5-triazine (CHEBI:30259) |
| 3-(4-tert-butylamino-6-methylthiol-s-triazin-2-ylamino)propionaldehyde (CHEBI:51112) has role antifouling biocide (CHEBI:51076) |
| 3-(4-tert-butylamino-6-methylthiol-s-triazin-2-ylamino)propionaldehyde (CHEBI:51112) has role metabolite (CHEBI:25212) |
| 3-(4-tert-butylamino-6-methylthiol-s-triazin-2-ylamino)propionaldehyde (CHEBI:51112) is a aldehyde (CHEBI:17478) |
| 3-(4-tert-butylamino-6-methylthiol-s-triazin-2-ylamino)propionaldehyde (CHEBI:51112) is a diamine (CHEBI:23666) |
| IUPAC Name |
|---|
| 3-{[4-(tert-butylamino)-6-(methylsulfanyl)-1,3,5-triazin-2-yl]amino}propanal |
| Synonym | Source |
|---|---|
| M2 | ChEBI |