EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4NO4S |
| Net Charge | 0 |
| Average Mass | 186.168 |
| Monoisotopic Mass | 185.98610 |
| SMILES | *S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| Roles Classification |
|---|
| Application: | protecting group A group that is introduced into a molecule by chemical modification of a functional group in order to obtain chemoselectivity in a subsequent chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nosyl group (CHEBI:51102) has role protecting group (CHEBI:51087) |
| nosyl group (CHEBI:51102) is a sulfonyl groups (CHEBI:51100) |
| IUPAC Names |
|---|
| (4-nitrophenyl)(dioxido)-λ6-sulfanyl |
| (4-nitrophenyl)sulfonyl |
| Synonym | Source |
|---|---|
| Ns group | ChEBI |