EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23N5O |
| Net Charge | 0 |
| Average Mass | 373.460 |
| Monoisotopic Mass | 373.19026 |
| SMILES | CC1(C)CNc2cc(NC(=O)c3cccnc3NCc3ccncc3)ccc21 |
| InChI | InChI=1S/C22H23N5O/c1-22(2)14-26-19-12-16(5-6-18(19)22)27-21(28)17-4-3-9-24-20(17)25-13-15-7-10-23-11-8-15/h3-12,26H,13-14H2,1-2H3,(H,24,25)(H,27,28) |
| InChIKey | RAHBGWKEPAQNFF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| motesanib (CHEBI:51098) has role antineoplastic agent (CHEBI:35610) |
| motesanib (CHEBI:51098) is a pyridinecarboxamide (CHEBI:25529) |
| IUPAC Name |
|---|
| N-(3,3-dimethyl-2,3-dihydro-1H-indol-6-yl)-2-[(pyridin-4-ylmethyl)amino]pyridine-3-carboxamide |
| INN | Source |
|---|---|
| motesanib | WHO MedNet |
| Synonyms | Source |
|---|---|
| AMG 706 | ChEMBL |
| AMG-706 | ChEMBL |
| N-(2,3-dihydro-3,3-dimethyl-1H-indol-6-yl)-2-((4-pyridinylmethyl)amino)-3-pyridinecarboxamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-1042 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:453562-69-1 | ChemIDplus |
| Citations |
|---|