EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19O2 |
| Net Charge | 0 |
| Average Mass | 303.381 |
| Monoisotopic Mass | 303.13850 |
| SMILES | *C(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| Roles Classification |
|---|
| Application: | protecting group A group that is introduced into a molecule by chemical modification of a functional group in order to obtain chemoselectivity in a subsequent chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4'-dimethoxytriphenylmethyl group (CHEBI:51095) has role protecting group (CHEBI:51087) |
| 4,4'-dimethoxytriphenylmethyl group (CHEBI:51095) is a benzylic group (CHEBI:33452) |
| IUPAC Name |
|---|
| bis(4-methoxyphenyl)(phenyl)methyl |
| Synonyms | Source |
|---|---|
| 4,4'-dimethoxytrityl group | ChEBI |
| DMT group | ChEBI |
| DMTr group | ChEBI |