EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19Si |
| Net Charge | 0 |
| Average Mass | 239.414 |
| Monoisotopic Mass | 239.12560 |
| SMILES | *[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| Roles Classification |
|---|
| Application: | protecting group A group that is introduced into a molecule by chemical modification of a functional group in order to obtain chemoselectivity in a subsequent chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tert-butyldiphenylsilyl group (CHEBI:51090) has role protecting group (CHEBI:51087) |
| tert-butyldiphenylsilyl group (CHEBI:51090) is a organosilyl group (CHEBI:33478) |
| IUPAC Name |
|---|
| tert-butyl(diphenyl)silyl |
| Synonym | Source |
|---|---|
| TBDPS group | ChEBI |