EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51083 - M3
| Formula | C12H23N5S |
| Net Charge | 0 |
| Average Mass | 269.418 |
| Monoisotopic Mass | 269.16742 |
| SMILES | CSc1nc(NC(C)(C)C)nc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C12H23N5S/c1-11(2,3)16-8-13-9(17-12(4,5)6)15-10(14-8)18-7/h1-7H3,(H2,13,14,15,16,17) |
| InChIKey | VONUTDHPPXOPTC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antifouling biocide A compound that inhibits the growth of marine organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| M3 (CHEBI:51083) has parent hydride 1,3,5-triazine (CHEBI:30259) |
| M3 (CHEBI:51083) has role antifouling biocide (CHEBI:51076) |
| M3 (CHEBI:51083) has role metabolite (CHEBI:25212) |
| M3 (CHEBI:51083) is a diamine (CHEBI:23666) |
| IUPAC Name |
|---|
| N,N'-di-tert-butyl-6-(methylsulfanyl)-1,3,5-triazine-2,4-diamine |
| Synonym | Source |
|---|---|
| N,N'-di-tert-butyl-6-methylthiol-s-triazine-2,4-diamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:614667 | Beilstein |
| CAS:5498-16-8 | Beilstein |