EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25NO6 |
| Net Charge | 0 |
| Average Mass | 399.443 |
| Monoisotopic Mass | 399.16819 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C22H25NO6/c1-12(24)23-16-8-6-13-10-19(27-3)21(28-4)22(29-5)20(13)14-7-9-18(26-2)17(25)11-15(14)16/h7,9-11,16H,6,8H2,1-5H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | IAKHMKGGTNLKSZ-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-colchicine (CHEBI:51074) is a colchicine (CHEBI:23359) |
| (R)-colchicine (CHEBI:51074) is enantiomer of (S)-colchicine (CHEBI:27882) |
| Incoming Relation(s) |
| (S)-colchicine (CHEBI:27882) is enantiomer of (R)-colchicine (CHEBI:51074) |
| IUPAC Name |
|---|
| N-[(7R)-1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]acetamide |
| Synonyms | Source |
|---|---|
| (+)-colchicine | ChemIDplus |
| (R)-N-(5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl)acetamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 48121 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3226657 | Beilstein |
| CAS:75520-89-7 | ChemIDplus |
| CAS:75520-89-7 | NIST Chemistry WebBook |
| Citations |
|---|