EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5106 - flunisolide
| Formula | C24H31FO6 |
| Net Charge | 0 |
| Average Mass | 434.504 |
| Monoisotopic Mass | 434.21047 |
| SMILES | [H][C@@]12C[C@@]3([H])OC(C)(C)O[C@@]3(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])C[C@H](F)C2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C24H31FO6/c1-21(2)30-19-9-14-13-8-16(25)15-7-12(27)5-6-22(15,3)20(13)17(28)10-23(14,4)24(19,31-21)18(29)11-26/h5-7,13-14,16-17,19-20,26,28H,8-11H2,1-4H3/t13-,14-,16-,17-,19+,20+,22-,23-,24+/m0/s1 |
| InChIKey | XSFJVAJPIHIPKU-XWCQMRHXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. anti-asthmatic drug A drug used to treat asthma. anti-asthmatic agent Any compound that has anti-asthmatic effects. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flunisolide (CHEBI:5106) has role anti-allergic agent (CHEBI:50857) |
| flunisolide (CHEBI:5106) has role anti-asthmatic agent (CHEBI:65023) |
| flunisolide (CHEBI:5106) has role anti-asthmatic drug (CHEBI:49167) |
| flunisolide (CHEBI:5106) has role anti-inflammatory drug (CHEBI:35472) |
| flunisolide (CHEBI:5106) has role immunosuppressive agent (CHEBI:35705) |
| flunisolide (CHEBI:5106) has role nasal decongestant (CHEBI:77715) |
| flunisolide (CHEBI:5106) is a 11β-hydroxy steroid (CHEBI:35346) |
| flunisolide (CHEBI:5106) is a 20-oxo steroid (CHEBI:36885) |
| flunisolide (CHEBI:5106) is a 21-hydroxy steroid (CHEBI:35344) |
| flunisolide (CHEBI:5106) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| flunisolide (CHEBI:5106) is a corticosteroid hormone (CHEBI:36699) |
| flunisolide (CHEBI:5106) is a cyclic ketal (CHEBI:59779) |
| flunisolide (CHEBI:5106) is a fluorinated steroid (CHEBI:50830) |
| flunisolide (CHEBI:5106) is a organic molecular entity (CHEBI:50860) |
| flunisolide (CHEBI:5106) is a primary α-hydroxy ketone (CHEBI:139590) |
| IUPAC Name |
|---|
| 6α-fluoro-11β,21-dihydroxy-16α,17α-(isopropylidenedioxy)pregna-1,4-diene-3,20-dione |
| INNs | Source |
|---|---|
| flunisolida | ChEBI |
| flunisolide | ChEBI |
| flunisolidum | ChEBI |
| Synonyms | Source |
|---|---|
| Flunisolide | KEGG COMPOUND |
| Flunisolide anhydrous | KEGG COMPOUND |
| Flunisolide hemihydrate | ChEMBL |
| NSC-757871 | ChEMBL |
| RS-3999 | ChEMBL |
| Brand Names | Source |
|---|---|
| Aerobid | ChEMBL |
| Aerospan | ChEMBL |
| Aerospan hfa | ChEMBL |
| Nasarel | ChEMBL |
| Syntaris | ChEMBL |
| Syntaris hayfever | ChEMBL |
| Citations |
|---|