EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23N5O |
| Net Charge | 0 |
| Average Mass | 301.394 |
| Monoisotopic Mass | 301.19026 |
| SMILES | CCCCCNC(=N)N/N=C/c1cnc2ccc(OC)cc12 |
| InChI | InChI=1S/C16H23N5O/c1-3-4-5-8-18-16(17)21-20-11-12-10-19-15-7-6-13(22-2)9-14(12)15/h6-7,9-11,19H,3-5,8H2,1-2H3,(H3,17,18,21)/b20-11+ |
| InChIKey | IKBKZGMPCYNSLU-RGVLZGJSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tegaserod (CHEBI:51043) has role gastrointestinal drug (CHEBI:55324) |
| tegaserod (CHEBI:51043) has role serotonergic agonist (CHEBI:35941) |
| tegaserod (CHEBI:51043) is a carboxamidine (CHEBI:35359) |
| tegaserod (CHEBI:51043) is a guanidines (CHEBI:24436) |
| tegaserod (CHEBI:51043) is a hydrazines (CHEBI:24631) |
| tegaserod (CHEBI:51043) is a indoles (CHEBI:24828) |
| Incoming Relation(s) |
| tegaserod maleate (CHEBI:51044) has part tegaserod (CHEBI:51043) |
| IUPAC Name |
|---|
| 2-[(5-methoxy-2,3-dihydro-1H-indol-3-yl)methylene]-N-pentylhydrazinecarboximidamide |
| INNs | Source |
|---|---|
| tegaserod | ChEBI |
| tegaserod | ChemIDplus |
| tégasérod | ChEBI |
| tegaserodum | ChEBI |
| Synonym | Source |
|---|---|
| 1-(((5-Methoxyindol-3-yl)methylene)amino)-3-pentylguanidine | ChemIDplus |