EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51038 - minaprine
| Formula | C17H22N4O |
| Net Charge | 0 |
| Average Mass | 298.390 |
| Monoisotopic Mass | 298.17936 |
| SMILES | Cc1cc(-c2ccccc2)nnc1NCCN1CCOCC1 |
| InChI | InChI=1S/C17H22N4O/c1-14-13-16(15-5-3-2-4-6-15)19-20-17(14)18-7-8-21-9-11-22-12-10-21/h2-6,13H,7-12H2,1H3,(H,18,20) |
| InChIKey | LDMWSLGGVTVJPG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| minaprine (CHEBI:51038) has role antidepressant (CHEBI:35469) |
| minaprine (CHEBI:51038) has role antiparkinson drug (CHEBI:48407) |
| minaprine (CHEBI:51038) has role cholinergic drug (CHEBI:38323) |
| minaprine (CHEBI:51038) has role dopamine uptake inhibitor (CHEBI:51039) |
| minaprine (CHEBI:51038) has role serotonin uptake inhibitor (CHEBI:50949) |
| minaprine (CHEBI:51038) is a morpholines (CHEBI:38785) |
| minaprine (CHEBI:51038) is a pyridazines (CHEBI:37921) |
| minaprine (CHEBI:51038) is a secondary amine (CHEBI:32863) |
| Incoming Relation(s) |
| minaprine hydrochloride (CHEBI:51040) has part minaprine (CHEBI:51038) |
| IUPAC Name |
|---|
| 4-methyl-N-(2-morpholin-4-ylethyl)-6-phenylpyridazin-3-amine |
| INNs | Source |
|---|---|
| minaprine | ChEBI |
| minaprina | ChEBI |
| minaprinum | ChEBI |
| Synonyms | Source |
|---|---|
| 4-(2-((4-Methyl-6-phenyl-3-pyridazinyl)amino)ethyl)morpholine | ChemIDplus |
| 4-Methyl-3-(2-morpholinoethylamino)-6-phenylpyridazin | ChemIDplus |
| N-(4-Methyl-6-phenyl-3-pyridazinyl)-4-morpholineethanamine | ChemIDplus |