EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31NO6 |
| Net Charge | 0 |
| Average Mass | 417.502 |
| Monoisotopic Mass | 417.21514 |
| SMILES | CCC/C(C)=C/C=C(\C)C(=O)c1c(O)cc(C(C)CC/C=C/NC(=O)OC)oc1=O |
| InChI | InChI=1S/C23H31NO6/c1-6-9-15(2)11-12-17(4)21(26)20-18(25)14-19(30-22(20)27)16(3)10-7-8-13-24-23(28)29-5/h8,11-14,16,25H,6-7,9-10H2,1-5H3,(H,24,28)/b13-8+,15-11+,17-12+ |
| InChIKey | UQFNCSLGZUJVQP-IDWZVPEXSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myxopyronin A (CHEBI:51033) is a 2-pyranones (CHEBI:75885) |
| myxopyronin A (CHEBI:51033) is a carbamate ester (CHEBI:23003) |
| myxopyronin A (CHEBI:51033) is a organooxygen heterocyclic antibiotic (CHEBI:25807) |
| IUPAC Name |
|---|
| methyl [(1E,5R)-5-{3-[(2E,4E)-2,5-dimethylocta-2,4-dienoyl]-4-hydroxy-2-oxo-2H-pyran-6-yl}hex-1-en-1-yl]carbamate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5313303 | Beilstein |
| CAS:88192-98-7 | ChemIDplus |