EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51024 - metixene
| Formula | C20H23NS |
| Net Charge | 0 |
| Average Mass | 309.478 |
| Monoisotopic Mass | 309.15512 |
| SMILES | CN1CCCC(CC2c3ccccc3Sc3ccccc32)C1 |
| InChI | InChI=1S/C20H23NS/c1-21-12-6-7-15(14-21)13-18-16-8-2-4-10-19(16)22-20-11-5-3-9-17(18)20/h2-5,8-11,15,18H,6-7,12-14H2,1H3 |
| InChIKey | MJFJKKXQDNNUJF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metixene (CHEBI:51024) has role antiparkinson drug (CHEBI:48407) |
| metixene (CHEBI:51024) has role histamine antagonist (CHEBI:37956) |
| metixene (CHEBI:51024) has role muscarinic antagonist (CHEBI:48876) |
| metixene (CHEBI:51024) is a piperidines (CHEBI:26151) |
| metixene (CHEBI:51024) is a thioxanthenes (CHEBI:50930) |
| Incoming Relation(s) |
| methixene hydrochloride (CHEBI:51025) has part metixene (CHEBI:51024) |
| IUPAC Name |
|---|
| 1-methyl-3-(9H-thioxanthen-9-ylmethyl)piperidine |
| INNs | Source |
|---|---|
| metixene | ChEBI |
| métixène | ChEBI |
| metixeno | ChEBI |
| metixenum | ChEBI |
| Synonyms | Source |
|---|---|
| Methixen | DrugBank |
| Metisene | DrugBank |