EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51024 - metixene
| Formula | C20H23NS |
| Net Charge | 0 |
| Average Mass | 309.478 |
| Monoisotopic Mass | 309.15512 |
| SMILES | CN1CCCC(CC2c3ccccc3Sc3ccccc32)C1 |
| InChI | InChI=1S/C20H23NS/c1-21-12-6-7-15(14-21)13-18-16-8-2-4-10-19(16)22-20-11-5-3-9-17(18)20/h2-5,8-11,15,18H,6-7,12-14H2,1H3 |
| InChIKey | MJFJKKXQDNNUJF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. antiparkinson drug A drug used in the treatment of Parkinson's disease. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metixene (CHEBI:51024) has role antiparkinson drug (CHEBI:48407) |
| metixene (CHEBI:51024) has role histamine antagonist (CHEBI:37956) |
| metixene (CHEBI:51024) has role muscarinic antagonist (CHEBI:48876) |
| metixene (CHEBI:51024) is a piperidines (CHEBI:26151) |
| metixene (CHEBI:51024) is a thioxanthenes (CHEBI:50930) |
| Incoming Relation(s) |
| methixene hydrochloride (CHEBI:51025) has part metixene (CHEBI:51024) |
| IUPAC Name |
|---|
| 1-methyl-3-(9H-thioxanthen-9-ylmethyl)piperidine |
| INNs | Source |
|---|---|
| metixene | ChEBI |
| metixenum | ChEBI |
| metixeno | ChEBI |
| métixène | ChEBI |
| Synonyms | Source |
|---|---|
| Methixen | DrugBank |
| Metisene | DrugBank |