EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O |
| Net Charge | 0 |
| Average Mass | 120.151 |
| Monoisotopic Mass | 120.05751 |
| SMILES | c1ccc([C@H]2CO2)cc1 |
| InChI | InChI=1S/C8H8O/c1-2-4-7(5-3-1)8-6-9-8/h1-5,8H,6H2/t8-/m1/s1 |
| InChIKey | AWMVMTVKBNGEAK-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-styrene oxide (CHEBI:51014) is a styrene oxide (CHEBI:17907) |
| (S)-styrene oxide (CHEBI:51014) is enantiomer of (R)-styrene oxide (CHEBI:45389) |
| Incoming Relation(s) |
| (S)-styrene glycol (CHEBI:231714) has functional parent (S)-styrene oxide (CHEBI:51014) |
| (R)-styrene oxide (CHEBI:45389) is enantiomer of (S)-styrene oxide (CHEBI:51014) |
| IUPAC Name |
|---|
| (2S)-2-phenyloxirane |
| Synonyms | Source |
|---|---|
| S-(epoxyethyl)benzene | ChemIDplus |
| S-phenyloxirane | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (S)-styrene oxide | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3587977 | Beilstein |
| Gmelin:863570 | Gmelin |
| CAS:20780-54-5 | ChemIDplus |