EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5100 - flucytosine
| Formula | C4H4FN3O |
| Net Charge | 0 |
| Average Mass | 129.094 |
| Monoisotopic Mass | 129.03384 |
| SMILES | Nc1nc(=O)ncc1F |
| InChI | InChI=1S/C4H4FN3O/c5-2-1-7-4(9)8-3(2)6/h1H,(H3,6,7,8,9) |
| InChIKey | XRECTZIEBJDKEO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flucytosine (CHEBI:5100) has functional parent cytosine (CHEBI:16040) |
| flucytosine (CHEBI:5100) has role antihypertensive agent (CHEBI:35674) |
| flucytosine (CHEBI:5100) has role antiinfective agent (CHEBI:35441) |
| flucytosine (CHEBI:5100) has role antimicrobial agent (CHEBI:33281) |
| flucytosine (CHEBI:5100) has role antineoplastic agent (CHEBI:35610) |
| flucytosine (CHEBI:5100) has role prodrug (CHEBI:50266) |
| flucytosine (CHEBI:5100) is a aminopyrimidine (CHEBI:38338) |
| flucytosine (CHEBI:5100) is a nucleoside analogue (CHEBI:60783) |
| flucytosine (CHEBI:5100) is a organofluorine compound (CHEBI:37143) |
| flucytosine (CHEBI:5100) is a pyrimidine antifungal drug (CHEBI:87205) |
| flucytosine (CHEBI:5100) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 4-amino-5-fluoropyrimidin-2(1H)-one |
| INNs | Source |
|---|---|
| flucitosina | WHO MedNet |
| flucytosina | WHO MedNet |
| flucytosine | WHO MedNet |
| flucytosine | WHO MedNet |
| flucytosinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-FC | KEGG DRUG |
| 5-Fluorocystosine | ChemIDplus |
| 5-Fluorocytosine | ChemIDplus |
| Ancobon (TN) | KEGG DRUG |
| NSC-103805 | ChEMBL |
| RO-29915 | ChEMBL |
| Brand Names | Source |
|---|---|
| Alcobon | ChEMBL |
| Ancoban | ChEMBL |
| Ancotil | ChemIDplus |
| Flourocytosine | ChEMBL |
| Fluorocytosine | ChEMBL |
| Citations |
|---|