EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4FN3O |
| Net Charge | 0 |
| Average Mass | 129.094 |
| Monoisotopic Mass | 129.03384 |
| SMILES | Nc1nc(=O)ncc1F |
| InChI | InChI=1S/C4H4FN3O/c5-2-1-7-4(9)8-3(2)6/h1H,(H3,6,7,8,9) |
| InChIKey | XRECTZIEBJDKEO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flucytosine (CHEBI:5100) has functional parent cytosine (CHEBI:16040) |
| flucytosine (CHEBI:5100) has role prodrug (CHEBI:50266) |
| flucytosine (CHEBI:5100) is a aminopyrimidine (CHEBI:38338) |
| flucytosine (CHEBI:5100) is a nucleoside analogue (CHEBI:60783) |
| flucytosine (CHEBI:5100) is a organofluorine compound (CHEBI:37143) |
| flucytosine (CHEBI:5100) is a pyrimidine antifungal drug (CHEBI:87205) |
| flucytosine (CHEBI:5100) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 4-amino-5-fluoropyrimidin-2(1H)-one |
| INNs | Source |
|---|---|
| flucytosina | WHO MedNet |
| flucytosine | WHO MedNet |
| flucytosine | WHO MedNet |
| flucytosinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-FC | KEGG DRUG |
| 5-Fluorocystosine | ChemIDplus |
| 5-Fluorocytosine | ChemIDplus |
| Ancobon (TN) | KEGG DRUG |
| Brand Name | Source |
|---|---|
| Ancotil | ChemIDplus |
| Citations |
|---|