EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H3NO2S |
| Net Charge | 0 |
| Average Mass | 117.129 |
| Monoisotopic Mass | 116.98845 |
| SMILES | O=C1CSC(=O)N1 |
| InChI | InChI=1S/C3H3NO2S/c5-2-1-7-3(6)4-2/h1H2,(H,4,5,6) |
| InChIKey | ZOBPZXTWZATXDG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. hypoglycemic agent A drug which lowers the blood glucose level. insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-thiazolidine-2,4-dione (CHEBI:50992) has parent hydride 1,3-thiazolidine (CHEBI:50120) |
| 1,3-thiazolidine-2,4-dione (CHEBI:50992) has role cardiovascular drug (CHEBI:35554) |
| 1,3-thiazolidine-2,4-dione (CHEBI:50992) has role hypoglycemic agent (CHEBI:35526) |
| 1,3-thiazolidine-2,4-dione (CHEBI:50992) has role insulin-sensitizing drug (CHEBI:50864) |
| 1,3-thiazolidine-2,4-dione (CHEBI:50992) is a thiazolidenedione (CHEBI:50991) |
| IUPAC Name |
|---|
| 1,3-thiazolidine-2,4-dione |
| Synonyms | Source |
|---|---|
| 2,4(3H,5H)-thiazoledione | NIST Chemistry WebBook |
| 2,4-dioxothiazolidine | ChemIDplus |
| 2,4-thiazolidinedione | NIST Chemistry WebBook |
| NSC-6745 | ChEMBL |
| Thiazolidine-2,4-dione | ChEMBL |
| thiazolidinedione | ChEMBL |
| Citations |
|---|