EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O7 |
| Net Charge | 0 |
| Average Mass | 382.368 |
| Monoisotopic Mass | 382.10525 |
| SMILES | C/C=C/C1=CC2=CC(=O)[C@@](C)(OC(=O)c3c(C)cc(O)cc3O)C(=O)C2=CO1 |
| InChI | InChI=1S/C21H18O7/c1-4-5-14-7-12-8-17(24)21(3,19(25)15(12)10-27-14)28-20(26)18-11(2)6-13(22)9-16(18)23/h4-10,22-23H,1-3H3/b5-4+/t21-/m1/s1 |
| InChIKey | ZLULUXWJVBHEMS-KTBYTZPXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium purpurogenum (ncbitaxon:28575) | mycelium (BTO:0001436) | PubMed (21879714) | Ethylacetate extract of fermentation broth and acetone extract of mycelia Strain: JS03 21 |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-mitorubrin (CHEBI:50945) is a mitorubrin (CHEBI:50943) |
| (−)-mitorubrin (CHEBI:50945) is enantiomer of (+)-mitorubrin (CHEBI:50944) |
| Incoming Relation(s) |
| (+)-mitorubrin (CHEBI:50944) is enantiomer of (−)-mitorubrin (CHEBI:50945) |
| IUPAC Name |
|---|
| (7R)-7-methyl-6,8-dioxo-3-[(1E)-prop-1-en-1-yl]-7,8-dihydro-6H-isochromen-7-yl 2,4-dihydroxy-6-methylbenzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8447891 | Reaxys |
| CAS:3403-71-2 | ChemIDplus |
| Citations |
|---|