EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16ClF3N4O3.C7H8O3S |
| Net Charge | 0 |
| Average Mass | 637.036 |
| Monoisotopic Mass | 636.10572 |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C21H16ClF3N4O3.C7H8O3S/c1-26-19(30)18-11-15(8-9-27-18)32-14-5-2-12(3-6-14)28-20(31)29-13-4-7-17(22)16(10-13)21(23,24)25;1-6-2-4-7(5-3-6)11(8,9)10/h2-11H,1H3,(H,26,30)(H2,28,29,31);2-5H,1H3,(H,8,9,10) |
| InChIKey | IVDHYUQIDRJSTI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sorafenib tosylate (CHEBI:50928) has part sorafenib (CHEBI:50924) |
| sorafenib tosylate (CHEBI:50928) has role antineoplastic agent (CHEBI:35610) |
| sorafenib tosylate (CHEBI:50928) has role antiviral agent (CHEBI:22587) |
| sorafenib tosylate (CHEBI:50928) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Name |
|---|
| 4-[4-({[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)phenoxy]-N-methylpyridine-2-carboxamide 4-methylbenzenesulfonate |
| Synonyms | Source |
|---|---|
| 1-(4-Chloro-3-(trifluoromethyl)phenyl)-3-(4-((2-(methylcarbamoyl)pyridin-4-yl)oxy)phenyl)urea mono(4-methylbenzenesulfonate) | ChemIDplus |
| -(4-(3-(4-Chloro-3-(trifluoromethyl)phenyl)ureido)phenoxy)-N2-methylpyridine-2-carboxamide mono (4-methylbenzenesulfonate) | ChemIDplus |
| BAY 54-9085 | ChEMBL |
| BAY-54-9085 | ChEMBL |
| Brand Names | Source |
|---|---|
| Nexavar | DrugBank |
| Sorafenib accord | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| DB00398 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:475207-59-1 | ChemIDplus |
| Citations |
|---|