EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O6 |
| Net Charge | 0 |
| Average Mass | 178.140 |
| Monoisotopic Mass | 178.04774 |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)CC(=O)O |
| WURCS | WURCS=2.0/1,1,0/[o212dA]/1/ |
| InChI | InChI=1S/C6H10O6/c7-2-4(9)6(12)3(8)1-5(10)11/h2-4,6,8-9,12H,1H2,(H,10,11)/t3-,4+,6+/m1/s1 |
| InChIKey | HPITTXOWHLWIEK-IWGUZYHVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-deoxy-D-glucuronic acid (CHEBI:50923) has functional parent D-glucuronic acid (CHEBI:4178) |
| 5-deoxy-D-glucuronic acid (CHEBI:50923) is a glucuronic acids (CHEBI:33886) |
| 5-deoxy-D-glucuronic acid (CHEBI:50923) is conjugate acid of 5-deoxy-D-glucuronate (CHEBI:58852) |
| Incoming Relation(s) |
| 5-deoxy-D-glucuronate (CHEBI:58852) is conjugate base of 5-deoxy-D-glucuronic acid (CHEBI:50923) |
| IUPAC Name |
|---|
| 5-deoxy-D-xylo-hexuronic acid |
| Synonym | Source |
|---|---|
| 5-Deoxy glucuronic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C16737 | KEGG COMPOUND |