EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O2 |
| Net Charge | 0 |
| Average Mass | 250.297 |
| Monoisotopic Mass | 250.09938 |
| SMILES | O=c1cc(CCc2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C17H14O2/c18-16-12-14(11-10-13-6-2-1-3-7-13)19-17-9-5-4-8-15(16)17/h1-9,12H,10-11H2 |
| InChIKey | VNZNWFQJBFLELF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aquilaria malaccensis (ncbitaxon:223753) | cell suspension culture (BTO:0000221) | DOI (/10.1007/s11240-017-1372-7) | |
| Aquilaria sinensis (ncbitaxon:210372) | - | PubMed (2618717) | |
| Imperata cylindrica (ncbitaxon:80369) | rhizome (BTO:0001181) | PubMed (16499335) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-phenylethyl)chromone (CHEBI:5092) has functional parent chromone (CHEBI:72013) |
| 2-(2-phenylethyl)chromone (CHEBI:5092) has role plant metabolite (CHEBI:76924) |
| 2-(2-phenylethyl)chromone (CHEBI:5092) is a benzenes (CHEBI:22712) |
| 2-(2-phenylethyl)chromone (CHEBI:5092) is a chromones (CHEBI:23238) |
| IUPAC Name |
|---|
| 2-(2-phenylethyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(2-phenylethyl)-4H-1-benzopyran-4-one | IUPAC |
| 2-(2-phenylethyl)chromen-4-one | ChEBI |
| 2-(2-phenylethyl)chromone | KEGG COMPOUND |
| 2-phenethylchromone | ChEBI |
| flidersiachromone | NIST Chemistry WebBook |
| flindersiachromone | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:61828-53-3 | NIST Chemistry WebBook |
| CAS:61828-53-3 | ChemIDplus |
| Citations |
|---|