EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20F6N2O3.C2H4O2 |
| Net Charge | 0 |
| Average Mass | 474.398 |
| Monoisotopic Mass | 474.15894 |
| SMILES | CC(=O)O.O=C(NCC1CCCCN1)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C17H20F6N2O3.C2H4O2/c18-16(19,20)9-27-12-4-5-14(28-10-17(21,22)23)13(7-12)15(26)25-8-11-3-1-2-6-24-11;1-2(3)4/h4-5,7,11,24H,1-3,6,8-10H2,(H,25,26);1H3,(H,3,4) |
| InChIKey | RKXNZRPQSOPPRN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flecainide acetate (CHEBI:5091) has part flecainide(1+) (CHEBI:76033) |
| flecainide acetate (CHEBI:5091) has role anti-arrhythmia drug (CHEBI:38070) |
| flecainide acetate (CHEBI:5091) is a acetate salt (CHEBI:59230) |
| IUPAC Names |
|---|
| N-(piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide acetate |
| 2-({[2,5-bis(2,2,2-trifluoroethoxy)benzoyl]amino}methyl)piperidinium acetate |
| Synonyms | Source |
|---|---|
| flecainide monoacetate | ChEBI |
| R 818 | ChemIDplus |
| N-(Piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide monoacetate | ChemIDplus |
| R-818 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Tambocor | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D00638 | KEGG DRUG |
| DB01195 | DrugBank |
| EP1918280 | Patent |
| Flecainide | Wikipedia |
| EP2359814 | Patent |
| WO2011098194 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4119882 | Reaxys |
| CAS:54143-56-5 | KEGG DRUG |
| CAS:54143-56-5 | ChemIDplus |
| Citations |
|---|