EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15N2O6S2 |
| Net Charge | -1 |
| Average Mass | 395.438 |
| Monoisotopic Mass | 395.03770 |
| SMILES | [H][C@]12SCC(COC(C)=O)=C(C(=O)[O-])N1C(=O)[C@@]2([H])NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C16H16N2O6S2/c1-8(19)24-6-9-7-26-15-12(14(21)18(15)13(9)16(22)23)17-11(20)5-10-3-2-4-25-10/h2-4,12,15H,5-7H2,1H3,(H,17,20)(H,22,23)/p-1/t12-,15-/m1/s1 |
| InChIKey | XIURVHNZVLADCM-IUODEOHRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefalotin(1−) (CHEBI:50897) is a carboxylic acid anion (CHEBI:29067) |
| cefalotin(1−) (CHEBI:50897) is conjugate base of cefalotin (CHEBI:124991) |
| Incoming Relation(s) |
| cefalotin (CHEBI:124991) is conjugate acid of cefalotin(1−) (CHEBI:50897) |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4165215 | Beilstein |