EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25NO4.HCl |
| Net Charge | 0 |
| Average Mass | 427.928 |
| Monoisotopic Mass | 427.15504 |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)OCCN3CCCCC3)cccc2c1=O.Cl |
| InChI | InChI=1S/C24H25NO4.ClH/c1-17-21(26)19-11-8-12-20(23(19)29-22(17)18-9-4-2-5-10-18)24(27)28-16-15-25-13-6-3-7-14-25;/h2,4-5,8-12H,3,6-7,13-16H2,1H3;1H |
| InChIKey | XOEVKNFZUQEERE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flavoxate hydrochloride (CHEBI:5089) has part flavoxate(1+) (CHEBI:61236) |
| flavoxate hydrochloride (CHEBI:5089) has role antispasmodic drug (CHEBI:53784) |
| flavoxate hydrochloride (CHEBI:5089) has role muscarinic antagonist (CHEBI:48876) |
| flavoxate hydrochloride (CHEBI:5089) has role parasympatholytic (CHEBI:50370) |
| flavoxate hydrochloride (CHEBI:5089) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-(2-{[(3-methyl-4-oxo-2-phenyl-4H-chromen-8-yl)carbonyl]oxy}ethyl)piperidinium chloride |
| Synonyms | Source |
|---|---|
| 2-(piperidin-1-yl)ethyl 3-methyl-4-oxo-2-phenyl-4H-chromene-8-carboxylate hydrochloride | IUPAC |
| 2-piperidinoethyl 3-methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-carboxylate hydrochloride | ChemIDplus |
| flavoxate HCl | ChemIDplus |
| Brand Name | Source |
|---|---|
| Urispas | KEGG DRUG |
| Citations |
|---|