EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25NO4.HCl |
| Net Charge | 0 |
| Average Mass | 427.928 |
| Monoisotopic Mass | 427.15504 |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)OCCN3CCCCC3)cccc2c1=O.Cl |
| InChI | InChI=1S/C24H25NO4.ClH/c1-17-21(26)19-11-8-12-20(23(19)29-22(17)18-9-4-2-5-10-18)24(27)28-16-15-25-13-6-3-7-14-25;/h2,4-5,8-12H,3,6-7,13-16H2,1H3;1H |
| InChIKey | XOEVKNFZUQEERE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flavoxate hydrochloride (CHEBI:5089) has part flavoxate(1+) (CHEBI:61236) |
| flavoxate hydrochloride (CHEBI:5089) has role antiinfective agent (CHEBI:35441) |
| flavoxate hydrochloride (CHEBI:5089) has role antispasmodic drug (CHEBI:53784) |
| flavoxate hydrochloride (CHEBI:5089) has role muscarinic antagonist (CHEBI:48876) |
| flavoxate hydrochloride (CHEBI:5089) has role parasympatholytic (CHEBI:50370) |
| flavoxate hydrochloride (CHEBI:5089) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-(2-{[(3-methyl-4-oxo-2-phenyl-4H-chromen-8-yl)carbonyl]oxy}ethyl)piperidinium chloride |
| Synonyms | Source |
|---|---|
| 2-(piperidin-1-yl)ethyl 3-methyl-4-oxo-2-phenyl-4H-chromene-8-carboxylate hydrochloride | IUPAC |
| 2-piperidinoethyl 3-methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-carboxylate hydrochloride | ChemIDplus |
| DW-61 | ChEMBL |
| flavoxate HCl | ChemIDplus |
| NSC-114649 | ChEMBL |
| Brand Names | Source |
|---|---|
| Urispas | KEGG DRUG |
| Urispas 200 | ChEMBL |
| Citations |
|---|