EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14Cl2O3 |
| Net Charge | 0 |
| Average Mass | 289.158 |
| Monoisotopic Mass | 288.03200 |
| SMILES | CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O |
| InChI | InChI=1S/C13H14Cl2O3/c1-12(2,11(16)17)18-9-5-3-8(4-6-9)10-7-13(10,14)15/h3-6,10H,7H2,1-2H3,(H,16,17) |
| InChIKey | KPSRODZRAIWAKH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciprofibrate (CHEBI:50867) has role antilipemic drug (CHEBI:35679) |
| ciprofibrate (CHEBI:50867) is a cyclopropanes (CHEBI:51454) |
| ciprofibrate (CHEBI:50867) is a monocarboxylic acid (CHEBI:25384) |
| ciprofibrate (CHEBI:50867) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoic acid |
| INNs | Source |
|---|---|
| ciprofibratum | ChemIDplus |
| ciprofibrato | ChemIDplus |
| ciprofibrate | KEGG DRUG |
| ciprofibrate | WHO MedNet |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1984981 | Reaxys |
| CAS:52214-84-3 | ChemIDplus |