EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33O5.Na |
| Net Charge | 0 |
| Average Mass | 412.502 |
| Monoisotopic Mass | 412.22257 |
| SMILES | [H][C@@]12Cc3c(cccc3OCC(=O)[O-])C[C@]1([H])[C@@H](CC[C@@H](O)CCCCC)[C@H](O)C2.[Na+] |
| InChI | InChI=1S/C23H34O5.Na/c1-2-3-4-7-17(24)9-10-18-19-11-15-6-5-8-22(28-14-23(26)27)20(15)12-16(19)13-21(18)25;/h5-6,8,16-19,21,24-25H,2-4,7,9-14H2,1H3,(H,26,27);/q;+1/p-1/t16-,17-,18+,19-,21+;/m0./s1 |
| InChIKey | IQKAWAUTOKVMLE-ZSESPEEFSA-M |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| treprostinil sodium (CHEBI:50863) has part treprostinil (CHEBI:50861) |
| treprostinil sodium (CHEBI:50863) has role antihypertensive agent (CHEBI:35674) |
| treprostinil sodium (CHEBI:50863) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium ({(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-5-yl}oxy)acetate |
| Synonyms | Source |
|---|---|
| Treprostinil sodium salt | ChEMBL |
| Yutrepia | ChEMBL |
| Brand Names | Source |
|---|---|
| Remodulin | DrugBank |
| Trepulmix | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| DB00374 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:289480-64-4 | ChemIDplus |