EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O2 |
| Net Charge | 0 |
| Average Mass | 348.486 |
| Monoisotopic Mass | 348.20893 |
| SMILES | C=C(c1ccc(C(=O)O)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H28O2/c1-15-13-20-21(24(5,6)12-11-23(20,3)4)14-19(15)16(2)17-7-9-18(10-8-17)22(25)26/h7-10,13-14H,2,11-12H2,1,3-6H3,(H,25,26) |
| InChIKey | NAVMQTYZDKMPEU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bexarotene (CHEBI:50859) has role antineoplastic agent (CHEBI:35610) |
| bexarotene (CHEBI:50859) is a benzoic acids (CHEBI:22723) |
| bexarotene (CHEBI:50859) is a naphthalenes (CHEBI:25477) |
| bexarotene (CHEBI:50859) is a retinoid (CHEBI:26537) |
| IUPAC Name |
|---|
| 4-[1-(3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalen-2-yl)vinyl]benzoic acid |
| INNs | Source |
|---|---|
| bexarotene | ChEBI |
| bexarotène | ChEBI |
| bexaroteno | ChEBI |
| bexarotenum | ChEBI |
| Synonym | Source |
|---|---|
| p-(1-(5,6,7,8-Tetrahydro-3,5,5,8,8-pentamethyl-2-naphthyl)vinyl)benzoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:153559-49-0 | ChemIDplus |