EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9ClF3N3O |
| Net Charge | 0 |
| Average Mass | 303.671 |
| Monoisotopic Mass | 303.03862 |
| SMILES | CNc1cnn(-c2cccc(C(F)(F)F)c2)c(=O)c1Cl |
| InChI | InChI=1S/C12H9ClF3N3O/c1-17-9-6-18-19(11(20)10(9)13)8-4-2-3-7(5-8)12(14,15)16/h2-6,17H,1H3 |
| InChIKey | NVGOPFQZYCNLDU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norflurazon (CHEBI:50842) has role agrochemical (CHEBI:33286) |
| norflurazon (CHEBI:50842) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| norflurazon (CHEBI:50842) has role herbicide (CHEBI:24527) |
| norflurazon (CHEBI:50842) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| norflurazon (CHEBI:50842) is a organochlorine compound (CHEBI:36683) |
| norflurazon (CHEBI:50842) is a pyridazinone (CHEBI:26414) |
| norflurazon (CHEBI:50842) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 4-chloro-5-(methylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3(2H)-one |
| Synonyms | Source |
|---|---|
| 4-chloro-5-(methylamino)-2-[3-(trifluoromethyl)phenyl]-3(2H)-pyridazinone | NIST Chemistry WebBook |
| 4-chloro-5-(methylamino)-2-(α,α,α-trifluoro-m-tolyl)-3(2H)-pyridazinone | NIST Chemistry WebBook |
| SAN 9789 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Solicam | ChemIDplus |
| Zorial | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:757115 | Beilstein |
| CAS:27314-13-2 | NIST Chemistry WebBook |
| CAS:27314-13-2 | ChemIDplus |
| CAS:27314-13-2 | KEGG COMPOUND |
| CAS:27314-13-2 | Alan Wood's Pesticides |
| Citations |
|---|