EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O3 |
| Net Charge | 0 |
| Average Mass | 366.501 |
| Monoisotopic Mass | 366.21949 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])([C@@H]4C[C@@H]4[C@@]34CCC(=O)O4)[C@]1([H])[C@H]1C[C@H]1C1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C24H30O3/c1-22-6-3-12(25)9-17(22)13-10-14(13)20-16(22)4-7-23(2)21(20)15-11-18(15)24(23)8-5-19(26)27-24/h9,13-16,18,20-21H,3-8,10-11H2,1-2H3/t13-,14+,15-,16+,18+,20-,21+,22-,23+,24+/m1/s1 |
| InChIKey | METQSPRSQINEEU-HXCATZOESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | progestin A synthetic progestogen. aldosterone antagonist A compound which inhibits or antagonizes the biosynthesis or actions of aldosterone. |
| Applications: | aldosterone antagonist A compound which inhibits or antagonizes the biosynthesis or actions of aldosterone. contraceptive drug A chemical substance that prevents or reduces the probability of conception. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| drospirenone (CHEBI:50838) has role aldosterone antagonist (CHEBI:50844) |
| drospirenone (CHEBI:50838) has role contraceptive drug (CHEBI:49323) |
| drospirenone (CHEBI:50838) has role progestin (CHEBI:59826) |
| drospirenone (CHEBI:50838) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| drospirenone (CHEBI:50838) is a steroid lactone (CHEBI:26766) |
| IUPAC Name |
|---|
| 3-oxo-6α,7α,15α,16α-tetrahydro-7'H,16'H-dicyclopropa[6,7;15,16]-17α-pregn-4-ene-21,17-carbolactone |
| INNs | Source |
|---|---|
| drospirenone | ChEBI |
| drospirénone | ChEBI |
| drospirenona | ChEBI |
| drospirenonum | ChEBI |
| Synonyms | Source |
|---|---|
| 1,2-Dihydrospirorenone | ChemIDplus |
| 6β,7β;15β,16β-Dimethylene-3-oxo-17α-pregn-4-ene-21,17-carbolactone | ChemIDplus |
| Dehydrospirorenone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4765500 | Beilstein |
| CAS:67392-87-4 | ChemIDplus |