EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31NO3 |
| Net Charge | 0 |
| Average Mass | 369.505 |
| Monoisotopic Mass | 369.23039 |
| SMILES | [H][C@@]12CCC3=C/C(=N/O)CC[C@]3([H])[C@@]1([H])CC[C@@]1(CC)[C@@]2([H])CC[C@]1(C#C)OC(C)=O |
| InChI | InChI=1S/C23H31NO3/c1-4-22-12-10-19-18-9-7-17(24-26)14-16(18)6-8-20(19)21(22)11-13-23(22,5-2)27-15(3)25/h2,14,18-21,26H,4,6-13H2,1,3H3/b24-17+/t18-,19+,20+,21-,22-,23-/m0/s1 |
| InChIKey | KIQQMECNKUGGKA-NMYWJIRASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | progestin A synthetic progestogen. |
| Applications: | synthetic oral contraceptive An oral contraceptive which owes its effectiveness to synthetic preparation. contraceptive drug A chemical substance that prevents or reduces the probability of conception. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norgestimate (CHEBI:50815) has role contraceptive drug (CHEBI:49323) |
| norgestimate (CHEBI:50815) has role progestin (CHEBI:59826) |
| norgestimate (CHEBI:50815) has role synthetic oral contraceptive (CHEBI:49326) |
| norgestimate (CHEBI:50815) is a ketoxime (CHEBI:24983) |
| norgestimate (CHEBI:50815) is a steroid ester (CHEBI:47880) |
| norgestimate (CHEBI:50815) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| (3E)-17α-ethynyl-3-(hydroxyimino)-18a-homoestr-4-en-17β-yl acetate |
| INNs | Source |
|---|---|
| norgestimate | ChEBI |
| norgestimato | ChemIDplus |
| norgestimatum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (+)-13-Ethyl-17-hydroxy-18,19-dinor-17α-pregn-4-en-20-yn-3-one oxime acetate (ester) | ChemIDplus |
| (17α)-17-(Acetyloxy)-13-ethyl-18,19-dinorpregn-4-en-20-yn-3-one 3-oxime | ChemIDplus |
| Dexnorgestrel acetime | ChemIDplus |
| d-13β-Ethyl-17α-ethynyl-17β-acetoxygon-4-en-3-one oxime | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:35189-28-7 | ChemIDplus |