EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31NO3 |
| Net Charge | 0 |
| Average Mass | 369.505 |
| Monoisotopic Mass | 369.23039 |
| SMILES | [H][C@@]12CCC3=C/C(=N/O)CC[C@]3([H])[C@@]1([H])CC[C@@]1(CC)[C@@]2([H])CC[C@]1(C#C)OC(C)=O |
| InChI | InChI=1S/C23H31NO3/c1-4-22-12-10-19-18-9-7-17(24-26)14-16(18)6-8-20(19)21(22)11-13-23(22,5-2)27-15(3)25/h2,14,18-21,26H,4,6-13H2,1,3H3/b24-17+/t18-,19+,20+,21-,22-,23-/m0/s1 |
| InChIKey | KIQQMECNKUGGKA-NMYWJIRASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | progestin A synthetic progestogen. antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. synthetic oral contraceptive An oral contraceptive which owes its effectiveness to synthetic preparation. contraceptive drug A chemical substance that prevents or reduces the probability of conception. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norgestimate (CHEBI:50815) has role anti-HIV agent (CHEBI:64946) |
| norgestimate (CHEBI:50815) has role antiviral agent (CHEBI:22587) |
| norgestimate (CHEBI:50815) has role bone density conservation agent (CHEBI:50646) |
| norgestimate (CHEBI:50815) has role contraceptive drug (CHEBI:49323) |
| norgestimate (CHEBI:50815) has role progestin (CHEBI:59826) |
| norgestimate (CHEBI:50815) has role synthetic oral contraceptive (CHEBI:49326) |
| norgestimate (CHEBI:50815) is a ketoxime (CHEBI:24983) |
| norgestimate (CHEBI:50815) is a steroid ester (CHEBI:47880) |
| norgestimate (CHEBI:50815) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| (3E)-17α-ethynyl-3-(hydroxyimino)-18a-homoestr-4-en-17β-yl acetate |
| INNs | Source |
|---|---|
| norgestimate | ChEBI |
| norgestimato | ChemIDplus |
| norgestimatum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (+)-13-Ethyl-17-hydroxy-18,19-dinor-17α-pregn-4-en-20-yn-3-one oxime acetate (ester) | ChemIDplus |
| (17α)-17-(Acetyloxy)-13-ethyl-18,19-dinorpregn-4-en-20-yn-3-one 3-oxime | ChemIDplus |
| d-13β-Ethyl-17α-ethynyl-17β-acetoxygon-4-en-3-one oxime | ChemIDplus |
| Dexnorgestrel acetime | ChemIDplus |
| NSC-759159 | ChEMBL |
| ORF 10131 | ChEMBL |
| Brand Names | Source |
|---|---|
| Norgestimate component of ortho tri-cyclen | ChEMBL |
| Norgestimate component of prefest | ChEMBL |
| Norgestimate component of previfem | ChEMBL |
| Norgestimate component of sprintec | ChEMBL |
| Norgestimate component of tri lo sprintec | ChEMBL |
| Norgestimate component of tri-previfem | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:35189-28-7 | ChemIDplus |
| Citations |
|---|